C15H20N2 — CID 62202042
N-ethyl-2,3,5,8-tetramethylquinolin-4-amine (PubChem CID 62202042) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-ethyl-2,3,5,8-tetramethylquinolin-4-amine.
| Compound Name | N-ethyl-2,3,5,8-tetramethylquinolin-4-amine |
|---|---|
| PubChem CID | 62202042 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-ethyl-2,3,5,8-tetramethylquinolin-4-amine |
| SMILES | CCNc1c(C)c(C)nc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C15H20N2/c1-6-16-15-11(4)12(5)17-14-10(3)8-7-9(2)13(14)15/h7-8H,6H2,1-5H3,(H,16,17) |
| InChIKey | OIMZHLBODJNBLI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |