C20H29N3 — CID 10662852
N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine (PubChem CID 10662852) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine.
| Compound Name | N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 10662852 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | N'-(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine |
| SMILES | NCCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H29N3/c21-14-8-2-1-3-9-15-22-20-16-10-4-6-12-18(16)23-19-13-7-5-11-17(19)20/h4,6,10,12H,1-3,5,7-9,11,13-15,21H2,(H,22,23) |
| InChIKey | ZEYCLUAFGXAMIV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|