C18H21N3 — CID 14169
N-acridin-9-yl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 14169) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-acridin-9-yl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-acridin-9-yl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 14169 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-acridin-9-yl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C18H21N3/c1-21(2)13-7-12-19-18-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)18/h3-6,8-11H,7,12-13H2,1-2H3,(H,19,20) |
| InChIKey | VJGUBCUGFXDMEX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|