C20H20N2 — CID 1933
N-benzyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 1933) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-benzyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-benzyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 1933 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-benzyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | c1ccc(CNc2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C20H20N2/c1-2-8-15(9-3-1)14-21-20-16-10-4-6-12-18(16)22-19-13-7-5-11-17(19)20/h1-4,6,8-10,12H,5,7,11,13-14H2,(H,21,22) |
| InChIKey | JYJAEHAURXXPSD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |