C13H12ClF2N — CID 103587093
4-chloro-3-ethyl-5,8-difluoro-2,6-dimethylquinoline (PubChem CID 103587093) has the molecular formula C13H12ClF2N and a molecular weight of 255.69 g/mol. Its IUPAC name is 4-chloro-3-ethyl-5,8-difluoro-2,6-dimethylquinoline.
| Compound Name | 4-chloro-3-ethyl-5,8-difluoro-2,6-dimethylquinoline |
|---|---|
| PubChem CID | 103587093 |
| Molecular Formula | C13H12ClF2N |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-chloro-3-ethyl-5,8-difluoro-2,6-dimethylquinoline |
| SMILES | CCc1c(C)nc2c(F)cc(C)c(F)c2c1Cl |
| InChI | InChI=1S/C13H12ClF2N/c1-4-8-7(3)17-13-9(15)5-6(2)12(16)10(13)11(8)14/h5H,4H2,1-3H3 |
| InChIKey | RMRDQBKMQOTPAL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |