C12H10Cl2IN — CID 107607583
4,8-dichloro-3-ethyl-6-iodo-2-methylquinoline (PubChem CID 107607583) has the molecular formula C12H10Cl2IN and a molecular weight of 366.03 g/mol. Its IUPAC name is 4,8-dichloro-3-ethyl-6-iodo-2-methylquinoline.
| Compound Name | 4,8-dichloro-3-ethyl-6-iodo-2-methylquinoline |
|---|---|
| PubChem CID | 107607583 |
| Molecular Formula | C12H10Cl2IN |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 4,8-dichloro-3-ethyl-6-iodo-2-methylquinoline |
| SMILES | CCc1c(C)nc2c(Cl)cc(I)cc2c1Cl |
| InChI | InChI=1S/C12H10Cl2IN/c1-3-8-6(2)16-12-9(11(8)14)4-7(15)5-10(12)13/h4-5H,3H2,1-2H3 |
| InChIKey | UHMHAWYYRAUFAC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|