C15H18Br2N2 — CID 63482930
5,8-dibromo-3-ethyl-2-methyl-N-propylquinolin-4-amine (PubChem CID 63482930) has the molecular formula C15H18Br2N2 and a molecular weight of 386.13 g/mol. Its IUPAC name is 5,8-dibromo-3-ethyl-2-methyl-N-propylquinolin-4-amine.
| Compound Name | 5,8-dibromo-3-ethyl-2-methyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63482930 |
| Molecular Formula | C15H18Br2N2 |
| Molecular Weight | 386.13 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 5,8-dibromo-3-ethyl-2-methyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(CC)c(C)nc2c(Br)ccc(Br)c12 |
| InChI | InChI=1S/C15H18Br2N2/c1-4-8-18-14-10(5-2)9(3)19-15-12(17)7-6-11(16)13(14)15/h6-7H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | YGAVXBFJPPIETJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |