C17H24N2 — CID 63480442
3-ethyl-2,7,8-trimethyl-N-propylquinolin-4-amine (PubChem CID 63480442) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-ethyl-2,7,8-trimethyl-N-propylquinolin-4-amine.
| Compound Name | 3-ethyl-2,7,8-trimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63480442 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-ethyl-2,7,8-trimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1c(CC)c(C)nc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C17H24N2/c1-6-10-18-17-14(7-2)13(5)19-16-12(4)11(3)8-9-15(16)17/h8-9H,6-7,10H2,1-5H3,(H,18,19) |
| InChIKey | ANKOQMPWLPFUJE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |