C12H12ClFN2 — CID 62203429
8-chloro-6-fluoro-N,2,3-trimethylquinolin-4-amine (PubChem CID 62203429) has the molecular formula C12H12ClFN2 and a molecular weight of 238.69 g/mol. Its IUPAC name is 8-chloro-6-fluoro-N,2,3-trimethylquinolin-4-amine.
| Compound Name | 8-chloro-6-fluoro-N,2,3-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 62203429 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 8-chloro-6-fluoro-N,2,3-trimethylquinolin-4-amine |
| SMILES | CNc1c(C)c(C)nc2c(Cl)cc(F)cc12 |
| InChI | InChI=1S/C12H12ClFN2/c1-6-7(2)16-12-9(11(6)15-3)4-8(14)5-10(12)13/h4-5H,1-3H3,(H,15,16) |
| InChIKey | UUAVUCQRANYDMB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |