C13H12ClF3N2 — CID 104722067
7-chloro-N,3,6-trimethyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 104722067) has the molecular formula C13H12ClF3N2 and a molecular weight of 288.70 g/mol. Its IUPAC name is 7-chloro-N,3,6-trimethyl-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | 7-chloro-N,3,6-trimethyl-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 104722067 |
| Molecular Formula | C13H12ClF3N2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 7-chloro-N,3,6-trimethyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CNc1c(C)c(C(F)(F)F)nc2cc(Cl)c(C)cc12 |
| InChI | InChI=1S/C13H12ClF3N2/c1-6-4-8-10(5-9(6)14)19-12(13(15,16)17)7(2)11(8)18-3/h4-5H,1-3H3,(H,18,19) |
| InChIKey | WXVBHTBSIYEKQV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |