C11H8BrF4N3 — CID 103996968
[6-bromo-7-fluoro-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 103996968) has the molecular formula C11H8BrF4N3 and a molecular weight of 338.10 g/mol. Its IUPAC name is [6-bromo-7-fluoro-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
| Compound Name | [6-bromo-7-fluoro-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 103996968 |
| Molecular Formula | C11H8BrF4N3 |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | [6-bromo-7-fluoro-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | Cc1c(C(F)(F)F)nc2cc(F)c(Br)cc2c1NN |
| InChI | InChI=1S/C11H8BrF4N3/c1-4-9(19-17)5-2-6(12)7(13)3-8(5)18-10(4)11(14,15)16/h2-3H,17H2,1H3,(H,18,19) |
| InChIKey | BLMFGZNMQAUWCT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|