C13H16FN3 — CID 103996238
(2-ethyl-7-fluoro-3,6-dimethylquinolin-4-yl)hydrazine (PubChem CID 103996238) has the molecular formula C13H16FN3 and a molecular weight of 233.29 g/mol. Its IUPAC name is (2-ethyl-7-fluoro-3,6-dimethylquinolin-4-yl)hydrazine.
| Compound Name | (2-ethyl-7-fluoro-3,6-dimethylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 103996238 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2-ethyl-7-fluoro-3,6-dimethylquinolin-4-yl)hydrazine |
| SMILES | CCc1nc2cc(F)c(C)cc2c(NN)c1C |
| InChI | InChI=1S/C13H16FN3/c1-4-11-8(3)13(17-15)9-5-7(2)10(14)6-12(9)16-11/h5-6H,4,15H2,1-3H3,(H,16,17) |
| InChIKey | YXJFARNLLIXNLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|