C13H13BrFN — CID 165443851
7-bromo-2-ethyl-6-fluoro-3,4-dimethylquinoline (PubChem CID 165443851) has the molecular formula C13H13BrFN and a molecular weight of 282.16 g/mol. Its IUPAC name is 7-bromo-2-ethyl-6-fluoro-3,4-dimethylquinoline.
| Compound Name | 7-bromo-2-ethyl-6-fluoro-3,4-dimethylquinoline |
|---|---|
| PubChem CID | 165443851 |
| Molecular Formula | C13H13BrFN |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 7-bromo-2-ethyl-6-fluoro-3,4-dimethylquinoline |
| SMILES | CCc1nc2cc(Br)c(F)cc2c(C)c1C |
| InChI | InChI=1S/C13H13BrFN/c1-4-12-8(3)7(2)9-5-11(15)10(14)6-13(9)16-12/h5-6H,4H2,1-3H3 |
| InChIKey | KSYSROFIEGFCGB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |