C14H16FN — CID 165443842
2-ethyl-6-fluoro-3,4,7-trimethylquinoline (PubChem CID 165443842) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-3,4,7-trimethylquinoline.
| Compound Name | 2-ethyl-6-fluoro-3,4,7-trimethylquinoline |
|---|---|
| PubChem CID | 165443842 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-ethyl-6-fluoro-3,4,7-trimethylquinoline |
| SMILES | CCc1nc2cc(C)c(F)cc2c(C)c1C |
| InChI | InChI=1S/C14H16FN/c1-5-13-10(4)9(3)11-7-12(15)8(2)6-14(11)16-13/h6-7H,5H2,1-4H3 |
| InChIKey | QQYAHGSMBGGORJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |