C9H5Cl2FN2 — CID 167510683
2,4-dichloro-6-fluoro-7-methylquinazoline (PubChem CID 167510683) has the molecular formula C9H5Cl2FN2 and a molecular weight of 231.06 g/mol. Its IUPAC name is 2,4-dichloro-6-fluoro-7-methylquinazoline.
| Compound Name | 2,4-dichloro-6-fluoro-7-methylquinazoline |
|---|---|
| PubChem CID | 167510683 |
| Molecular Formula | C9H5Cl2FN2 |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 2,4-dichloro-6-fluoro-7-methylquinazoline |
| SMILES | Cc1cc2nc(Cl)nc(Cl)c2cc1F |
| InChI | InChI=1S/C9H5Cl2FN2/c1-4-2-7-5(3-6(4)12)8(10)14-9(11)13-7/h2-3H,1H3 |
| InChIKey | WWDZNUTUWLDNKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |