C12H11BrFNO — CID 178041010
(2-bromo-7-fluoro-4,6-dimethylquinolin-3-yl)methanol (PubChem CID 178041010) has the molecular formula C12H11BrFNO and a molecular weight of 284.13 g/mol. Its IUPAC name is (2-bromo-7-fluoro-4,6-dimethylquinolin-3-yl)methanol.
| Compound Name | (2-bromo-7-fluoro-4,6-dimethylquinolin-3-yl)methanol |
|---|---|
| PubChem CID | 178041010 |
| Molecular Formula | C12H11BrFNO |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (2-bromo-7-fluoro-4,6-dimethylquinolin-3-yl)methanol |
| SMILES | Cc1cc2c(C)c(CO)c(Br)nc2cc1F |
| InChI | InChI=1S/C12H11BrFNO/c1-6-3-8-7(2)9(5-16)12(13)15-11(8)4-10(6)14/h3-4,16H,5H2,1-2H3 |
| InChIKey | RFKAIONQHRATLP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|