C12H14F2OSi — CID 151363788
[2,6-difluoro-4-(2-trimethylsilylethynyl)phenyl]methanol (PubChem CID 151363788) has the molecular formula C12H14F2OSi and a molecular weight of 240.32 g/mol. Its IUPAC name is [2,6-difluoro-4-(2-trimethylsilylethynyl)phenyl]methanol.
| Compound Name | [2,6-difluoro-4-(2-trimethylsilylethynyl)phenyl]methanol |
|---|---|
| PubChem CID | 151363788 |
| Molecular Formula | C12H14F2OSi |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [2,6-difluoro-4-(2-trimethylsilylethynyl)phenyl]methanol |
| SMILES | C[Si](C)(C)C#Cc1cc(F)c(CO)c(F)c1 |
| InChI | InChI=1S/C12H14F2OSi/c1-16(2,3)5-4-9-6-11(13)10(8-15)12(14)7-9/h6-7,15H,8H2,1-3H3 |
| InChIKey | OOZYFBOCRRAKHP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|