C8H6F4O — CID 131189605
[4-(difluoromethyl)-2,6-difluorophenyl]methanol (PubChem CID 131189605) has the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. Its IUPAC name is [4-(difluoromethyl)-2,6-difluorophenyl]methanol.
| Compound Name | [4-(difluoromethyl)-2,6-difluorophenyl]methanol |
|---|---|
| PubChem CID | 131189605 |
| Molecular Formula | C8H6F4O |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | [4-(difluoromethyl)-2,6-difluorophenyl]methanol |
| SMILES | OCc1c(F)cc(C(F)F)cc1F |
| InChI | InChI=1S/C8H6F4O/c9-6-1-4(8(11)12)2-7(10)5(6)3-13/h1-2,8,13H,3H2 |
| InChIKey | APUSHCPLMCKERR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |