About 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene
5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene (PubChem CID 130837151) has the molecular formula C9H9F3
and a molecular weight of 174.16 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene.
Analyze 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene?
The IUPAC name of 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene (CID 130837151) is 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene.
What is the SMILES notation for 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene?
The canonical SMILES for 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene is Cc1cc(C(F)F)cc(F)c1C.
What is the InChIKey of 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene?
The InChIKey is UWQIGMSPWJFBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3/c1-5-3-7(9(11)12)4-8(10)6(5)2/h3-4,9H,1-2H3.
What are the key properties of 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene?
5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene has a molecular weight of 174.16 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-1-fluoro-2,3-dimethylbenzene is sourced from PubChem (CID 130837151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).