C12H18FN — CID 84773685
3-(3-fluoro-4,5-dimethylphenyl)butan-1-amine (PubChem CID 84773685) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is 3-(3-fluoro-4,5-dimethylphenyl)butan-1-amine.
| Compound Name | 3-(3-fluoro-4,5-dimethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 84773685 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(3-fluoro-4,5-dimethylphenyl)butan-1-amine |
| SMILES | Cc1cc(C(C)CCN)cc(F)c1C |
| InChI | InChI=1S/C12H18FN/c1-8(4-5-14)11-6-9(2)10(3)12(13)7-11/h6-8H,4-5,14H2,1-3H3 |
| InChIKey | RTIXVRYLZRPEDO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |