C13H19F2N — CID 117327295
3-(2,3-difluoro-5-propan-2-ylphenyl)butan-1-amine (PubChem CID 117327295) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-(2,3-difluoro-5-propan-2-ylphenyl)butan-1-amine.
| Compound Name | 3-(2,3-difluoro-5-propan-2-ylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117327295 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(2,3-difluoro-5-propan-2-ylphenyl)butan-1-amine |
| SMILES | CC(C)c1cc(F)c(F)c(C(C)CCN)c1 |
| InChI | InChI=1S/C13H19F2N/c1-8(2)10-6-11(9(3)4-5-16)13(15)12(14)7-10/h6-9H,4-5,16H2,1-3H3 |
| InChIKey | UTPACVQTXZSUJL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |