C9H11F3N2 — CID 130900225
1-(2,3,5-trifluorophenyl)propane-1,3-diamine (PubChem CID 130900225) has the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-(2,3,5-trifluorophenyl)propane-1,3-diamine.
| Compound Name | 1-(2,3,5-trifluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 130900225 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(2,3,5-trifluorophenyl)propane-1,3-diamine |
| SMILES | NCCC(N)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C9H11F3N2/c10-5-3-6(8(14)1-2-13)9(12)7(11)4-5/h3-4,8H,1-2,13-14H2 |
| InChIKey | ZWLBIDRBXSRJFA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|