C9H13BrClFN2O — CID 171257029
2-bromo-6-[(1R)-1,3-diaminopropyl]-4-fluorophenol;hydrochloride (PubChem CID 171257029) has the molecular formula C9H13BrClFN2O and a molecular weight of 299.57 g/mol. Its IUPAC name is 2-bromo-6-[(1R)-1,3-diaminopropyl]-4-fluorophenol;hydrochloride.
| Compound Name | 2-bromo-6-[(1R)-1,3-diaminopropyl]-4-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257029 |
| Molecular Formula | C9H13BrClFN2O |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-bromo-6-[(1R)-1,3-diaminopropyl]-4-fluorophenol;hydrochloride |
| SMILES | Cl.NCC[C@@H](N)c1cc(F)cc(Br)c1O |
| InChI | InChI=1S/C9H12BrFN2O.ClH/c10-7-4-5(11)3-6(9(7)14)8(13)1-2-12;/h3-4,8,14H,1-2,12-13H2;1H/t8-;/m1./s1 |
| InChIKey | VLLUUTIGIQRBSI-DDWIOCJRSA-N |
| XLogP | 2.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|