C8H11BrClFN2O — CID 171257019
2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol;hydrochloride (PubChem CID 171257019) has the molecular formula C8H11BrClFN2O and a molecular weight of 285.54 g/mol. Its IUPAC name is 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol;hydrochloride.
| Compound Name | 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171257019 |
| Molecular Formula | C8H11BrClFN2O |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol;hydrochloride |
| SMILES | Cl.NC[C@@H](N)c1cc(F)cc(Br)c1O |
| InChI | InChI=1S/C8H10BrFN2O.ClH/c9-6-2-4(10)1-5(8(6)13)7(12)3-11;/h1-2,7,13H,3,11-12H2;1H/t7-;/m1./s1 |
| InChIKey | GKIXNZFYXJVOPI-OGFXRTJISA-N |
| XLogP | 1.67 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|