C9H10BrN3O — CID 130797872
3-bromo-5-[(1S)-1,2-diaminoethyl]-4-hydroxybenzonitrile (PubChem CID 130797872) has the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. Its IUPAC name is 3-bromo-5-[(1S)-1,2-diaminoethyl]-4-hydroxybenzonitrile.
| Compound Name | 3-bromo-5-[(1S)-1,2-diaminoethyl]-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 130797872 |
| Molecular Formula | C9H10BrN3O |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 3-bromo-5-[(1S)-1,2-diaminoethyl]-4-hydroxybenzonitrile |
| SMILES | N#Cc1cc(Br)c(O)c([C@H](N)CN)c1 |
| InChI | InChI=1S/C9H10BrN3O/c10-7-2-5(3-11)1-6(9(7)14)8(13)4-12/h1-2,8,14H,4,12-13H2/t8-/m1/s1 |
| InChIKey | IALUVNKAGIMYRD-MRVPVSSYSA-N |
| XLogP | 0.98 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|