C10H13ClFN3O — CID 171257777
3-[(1R)-1,3-diaminopropyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride (PubChem CID 171257777) has the molecular formula C10H13ClFN3O and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-[(1R)-1,3-diaminopropyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride.
| Compound Name | 3-[(1R)-1,3-diaminopropyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171257777 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[(1R)-1,3-diaminopropyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(F)c(O)c([C@H](N)CCN)c1 |
| InChI | InChI=1S/C10H12FN3O.ClH/c11-8-4-6(5-13)3-7(10(8)15)9(14)1-2-12;/h3-4,9,15H,1-2,12,14H2;1H/t9-;/m1./s1 |
| InChIKey | PAGUZDJAEAHXCD-SBSPUUFOSA-N |
| XLogP | 1.17 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|