C11H11FN2O3 — CID 171254403
methyl (3S)-3-amino-3-(5-cyano-3-fluoro-2-hydroxyphenyl)propanoate (PubChem CID 171254403) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(5-cyano-3-fluoro-2-hydroxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(5-cyano-3-fluoro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171254403 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl (3S)-3-amino-3-(5-cyano-3-fluoro-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1cc(C#N)cc(F)c1O |
| InChI | InChI=1S/C11H11FN2O3/c1-17-10(15)4-9(14)7-2-6(5-13)3-8(12)11(7)16/h2-3,9,16H,4,14H2,1H3/t9-/m0/s1 |
| InChIKey | MFYKSEJOPULRQB-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|