C13H15FN2O — CID 171254416
3-[(S)-amino(cyclopentyl)methyl]-5-fluoro-4-hydroxybenzonitrile (PubChem CID 171254416) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-[(S)-amino(cyclopentyl)methyl]-5-fluoro-4-hydroxybenzonitrile.
| Compound Name | 3-[(S)-amino(cyclopentyl)methyl]-5-fluoro-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171254416 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-[(S)-amino(cyclopentyl)methyl]-5-fluoro-4-hydroxybenzonitrile |
| SMILES | N#Cc1cc(F)c(O)c([C@@H](N)C2CCCC2)c1 |
| InChI | InChI=1S/C13H15FN2O/c14-11-6-8(7-15)5-10(13(11)17)12(16)9-3-1-2-4-9/h5-6,9,12,17H,1-4,16H2/t12-/m0/s1 |
| InChIKey | ONZNNVPHABBBLQ-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|