C11H11BrN2O — CID 131382433
3-[(R)-amino(cyclopropyl)methyl]-5-bromo-4-hydroxybenzonitrile (PubChem CID 131382433) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 3-[(R)-amino(cyclopropyl)methyl]-5-bromo-4-hydroxybenzonitrile.
| Compound Name | 3-[(R)-amino(cyclopropyl)methyl]-5-bromo-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 131382433 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-[(R)-amino(cyclopropyl)methyl]-5-bromo-4-hydroxybenzonitrile |
| SMILES | N#Cc1cc(Br)c(O)c([C@H](N)C2CC2)c1 |
| InChI | InChI=1S/C11H11BrN2O/c12-9-4-6(5-13)3-8(11(9)15)10(14)7-1-2-7/h3-4,7,10,15H,1-2,14H2/t10-/m1/s1 |
| InChIKey | ZDZNKTDHYVCZHW-SNVBAGLBSA-N |
| XLogP | 2.44 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|