C12H15ClN2O2 — CID 171254966
3-[(S)-amino(cyclopropyl)methyl]-4-hydroxy-5-methoxybenzonitrile;hydrochloride (PubChem CID 171254966) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 3-[(S)-amino(cyclopropyl)methyl]-4-hydroxy-5-methoxybenzonitrile;hydrochloride.
| Compound Name | 3-[(S)-amino(cyclopropyl)methyl]-4-hydroxy-5-methoxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171254966 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-[(S)-amino(cyclopropyl)methyl]-4-hydroxy-5-methoxybenzonitrile;hydrochloride |
| SMILES | COc1cc(C#N)cc([C@@H](N)C2CC2)c1O.Cl |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-16-10-5-7(6-13)4-9(12(10)15)11(14)8-2-3-8;/h4-5,8,11,15H,2-3,14H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | JINRGQWASIZIRZ-MERQFXBCSA-N |
| XLogP | 2.10 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|