C13H16N2O2 — CID 171258326
3-[(1R)-1-amino-2-cyclopropylethyl]-4-hydroxy-5-methoxybenzonitrile (PubChem CID 171258326) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2-cyclopropylethyl]-4-hydroxy-5-methoxybenzonitrile.
| Compound Name | 3-[(1R)-1-amino-2-cyclopropylethyl]-4-hydroxy-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 171258326 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[(1R)-1-amino-2-cyclopropylethyl]-4-hydroxy-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc([C@H](N)CC2CC2)c1O |
| InChI | InChI=1S/C13H16N2O2/c1-17-12-6-9(7-14)4-10(13(12)16)11(15)5-8-2-3-8/h4,6,8,11,16H,2-3,5,15H2,1H3/t11-/m1/s1 |
| InChIKey | FEELUJQTRMNJHA-LLVKDONJSA-N |
| XLogP | 2.07 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|