C11H12N2O — CID 55263376
3-[(R)-amino(cyclopropyl)methyl]-4-hydroxybenzonitrile (PubChem CID 55263376) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-[(R)-amino(cyclopropyl)methyl]-4-hydroxybenzonitrile.
| Compound Name | 3-[(R)-amino(cyclopropyl)methyl]-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 55263376 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-[(R)-amino(cyclopropyl)methyl]-4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)c([C@H](N)C2CC2)c1 |
| InChI | InChI=1S/C11H12N2O/c12-6-7-1-4-10(14)9(5-7)11(13)8-2-3-8/h1,4-5,8,11,14H,2-3,13H2/t11-/m1/s1 |
| InChIKey | FXESWEYUPAKMLU-LLVKDONJSA-N |
| XLogP | 1.67 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|