C10H14ClN3O — CID 171254106
3-[(1S)-1,3-diaminopropyl]-4-hydroxybenzonitrile;hydrochloride (PubChem CID 171254106) has the molecular formula C10H14ClN3O and a molecular weight of 227.70 g/mol. Its IUPAC name is 3-[(1S)-1,3-diaminopropyl]-4-hydroxybenzonitrile;hydrochloride.
| Compound Name | 3-[(1S)-1,3-diaminopropyl]-4-hydroxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171254106 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-[(1S)-1,3-diaminopropyl]-4-hydroxybenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(O)c([C@@H](N)CCN)c1 |
| InChI | InChI=1S/C10H13N3O.ClH/c11-4-3-9(13)8-5-7(6-12)1-2-10(8)14;/h1-2,5,9,14H,3-4,11,13H2;1H/t9-;/m0./s1 |
| InChIKey | NXEUAPPBWGBOPS-FVGYRXGTSA-N |
| XLogP | 1.03 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|