C10H11FN2O — CID 55295827
3-(1-amino-3-hydroxypropyl)-4-fluorobenzonitrile (PubChem CID 55295827) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-(1-amino-3-hydroxypropyl)-4-fluorobenzonitrile.
| Compound Name | 3-(1-amino-3-hydroxypropyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 55295827 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(1-amino-3-hydroxypropyl)-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(C(N)CCO)c1 |
| InChI | InChI=1S/C10H11FN2O/c11-9-2-1-7(6-12)5-8(9)10(13)3-4-14/h1-2,5,10,14H,3-4,13H2 |
| InChIKey | STWIUGPMVXJUCO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |