C9H11N3O2 — CID 130610769
3-[(1S)-1,2-diaminoethyl]-2,5-dihydroxybenzonitrile (PubChem CID 130610769) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-[(1S)-1,2-diaminoethyl]-2,5-dihydroxybenzonitrile.
| Compound Name | 3-[(1S)-1,2-diaminoethyl]-2,5-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 130610769 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-[(1S)-1,2-diaminoethyl]-2,5-dihydroxybenzonitrile |
| SMILES | N#Cc1cc(O)cc([C@H](N)CN)c1O |
| InChI | InChI=1S/C9H11N3O2/c10-3-5-1-6(13)2-7(9(5)14)8(12)4-11/h1-2,8,13-14H,4,11-12H2/t8-/m1/s1 |
| InChIKey | XSYRVOIKPAWKLL-MRVPVSSYSA-N |
| XLogP | -0.07 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|