C9H10FN3 — CID 66516228
2-[(1S)-1,2-diaminoethyl]-4-fluorobenzonitrile (PubChem CID 66516228) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-[(1S)-1,2-diaminoethyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(1S)-1,2-diaminoethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 66516228 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-[(1S)-1,2-diaminoethyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1[C@H](N)CN |
| InChI | InChI=1S/C9H10FN3/c10-7-2-1-6(4-11)8(3-7)9(13)5-12/h1-3,9H,5,12-13H2/t9-/m1/s1 |
| InChIKey | MIUYIGZZXSORQI-SECBINFHSA-N |
| XLogP | 0.66 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |