C8H10ClFN2 — CID 55270283
1-(2-chloro-4-fluorophenyl)ethane-1,2-diamine (PubChem CID 55270283) has the molecular formula C8H10ClFN2 and a molecular weight of 188.63 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-chloro-4-fluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55270283 |
| Molecular Formula | C8H10ClFN2 |
| Molecular Weight | 188.63 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C8H10ClFN2/c9-7-3-5(10)1-2-6(7)8(12)4-11/h1-3,8H,4,11-12H2 |
| InChIKey | SLFSQUZBFDAMPF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |