C8H10BrFN2 — CID 66517956
(1R)-1-(2-bromo-4-fluorophenyl)ethane-1,2-diamine (PubChem CID 66517956) has the molecular formula C8H10BrFN2 and a molecular weight of 233.08 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4-fluorophenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(2-bromo-4-fluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517956 |
| Molecular Formula | C8H10BrFN2 |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | (1R)-1-(2-bromo-4-fluorophenyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1ccc(F)cc1Br |
| InChI | InChI=1S/C8H10BrFN2/c9-7-3-5(10)1-2-6(7)8(12)4-11/h1-3,8H,4,11-12H2/t8-/m0/s1 |
| InChIKey | DAPFBRCCNZYDCI-QMMMGPOBSA-N |
| XLogP | 1.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |