C14H11Br2F2N — CID 115843294
1,2-bis(2-bromo-4-fluorophenyl)ethanamine (PubChem CID 115843294) has the molecular formula C14H11Br2F2N and a molecular weight of 391.05 g/mol. Its IUPAC name is 1,2-bis(2-bromo-4-fluorophenyl)ethanamine.
| Compound Name | 1,2-bis(2-bromo-4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 115843294 |
| Molecular Formula | C14H11Br2F2N |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 1,2-bis(2-bromo-4-fluorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(F)cc1Br)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H11Br2F2N/c15-12-6-9(17)2-1-8(12)5-14(19)11-4-3-10(18)7-13(11)16/h1-4,6-7,14H,5,19H2 |
| InChIKey | GHNUVSZBOSDDRK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |