C13H8BrF4N — CID 103301576
(2-bromo-4-fluorophenyl)-(2,4,5-trifluorophenyl)methanamine (PubChem CID 103301576) has the molecular formula C13H8BrF4N and a molecular weight of 334.11 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(2,4,5-trifluorophenyl)methanamine.
| Compound Name | (2-bromo-4-fluorophenyl)-(2,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 103301576 |
| Molecular Formula | C13H8BrF4N |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(2,4,5-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(F)c(F)cc1F)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H8BrF4N/c14-9-3-6(15)1-2-7(9)13(19)8-4-11(17)12(18)5-10(8)16/h1-5,13H,19H2 |
| InChIKey | JJTDGCDULAYQNN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|