C14H11ClF3N — CID 55152610
1-(2-chloro-4-fluorophenyl)-2-(2,4-difluorophenyl)ethanamine (PubChem CID 55152610) has the molecular formula C14H11ClF3N and a molecular weight of 285.70 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-2-(2,4-difluorophenyl)ethanamine.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-2-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 55152610 |
| Molecular Formula | C14H11ClF3N |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-2-(2,4-difluorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(F)cc1F)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H11ClF3N/c15-12-6-9(16)3-4-11(12)14(19)5-8-1-2-10(17)7-13(8)18/h1-4,6-7,14H,5,19H2 |
| InChIKey | BBLSSSUUJDYEHX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |