C9H10BrN3 — CID 130741286
2-bromo-4-[(1R)-1,2-diaminoethyl]benzonitrile (PubChem CID 130741286) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-bromo-4-[(1R)-1,2-diaminoethyl]benzonitrile.
| Compound Name | 2-bromo-4-[(1R)-1,2-diaminoethyl]benzonitrile |
|---|---|
| PubChem CID | 130741286 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 2-bromo-4-[(1R)-1,2-diaminoethyl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H](N)CN)cc1Br |
| InChI | InChI=1S/C9H10BrN3/c10-8-3-6(9(13)5-12)1-2-7(8)4-11/h1-3,9H,5,12-13H2/t9-/m0/s1 |
| InChIKey | XKERODYAPOFRLT-VIFPVBQESA-N |
| XLogP | 1.28 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |