C8H12BrN3 — CID 130674111
(1S)-1-(4-amino-3-bromophenyl)ethane-1,2-diamine (PubChem CID 130674111) has the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. Its IUPAC name is (1S)-1-(4-amino-3-bromophenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(4-amino-3-bromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130674111 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (1S)-1-(4-amino-3-bromophenyl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C8H12BrN3/c9-6-3-5(8(12)4-10)1-2-7(6)11/h1-3,8H,4,10-12H2/t8-/m1/s1 |
| InChIKey | CXTQZXHGRBKZQN-MRVPVSSYSA-N |
| XLogP | 0.99 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|