C9H12N4 — CID 66516116
2-amino-5-[(1S)-1,2-diaminoethyl]benzonitrile (PubChem CID 66516116) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-amino-5-[(1S)-1,2-diaminoethyl]benzonitrile.
| Compound Name | 2-amino-5-[(1S)-1,2-diaminoethyl]benzonitrile |
|---|---|
| PubChem CID | 66516116 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-amino-5-[(1S)-1,2-diaminoethyl]benzonitrile |
| SMILES | N#Cc1cc([C@H](N)CN)ccc1N |
| InChI | InChI=1S/C9H12N4/c10-4-7-3-6(9(13)5-11)1-2-8(7)12/h1-3,9H,5,11-13H2/t9-/m1/s1 |
| InChIKey | DQJWEDBSXUEHID-SECBINFHSA-N |
| XLogP | 0.10 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|