C8H10BrFN2O — CID 130699524
2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol (PubChem CID 130699524) has the molecular formula C8H10BrFN2O and a molecular weight of 249.08 g/mol. Its IUPAC name is 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol.
| Compound Name | 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol |
|---|---|
| PubChem CID | 130699524 |
| Molecular Formula | C8H10BrFN2O |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-bromo-6-[(1S)-1,2-diaminoethyl]-4-fluorophenol |
| SMILES | NC[C@@H](N)c1cc(F)cc(Br)c1O |
| InChI | InChI=1S/C8H10BrFN2O/c9-6-2-4(10)1-5(8(6)13)7(12)3-11/h1-2,7,13H,3,11-12H2/t7-/m1/s1 |
| InChIKey | ZQNNMQZGDUSFKJ-SSDOTTSWSA-N |
| XLogP | 1.25 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|