C9H9ClF5N — CID 171313036
(1S)-3,3-difluoro-1-(2,3,5-trifluorophenyl)propan-1-amine;hydrochloride (PubChem CID 171313036) has the molecular formula C9H9ClF5N and a molecular weight of 261.62 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-(2,3,5-trifluorophenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-3,3-difluoro-1-(2,3,5-trifluorophenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171313036 |
| Molecular Formula | C9H9ClF5N |
| Molecular Weight | 261.62 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | (1S)-3,3-difluoro-1-(2,3,5-trifluorophenyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CC(F)F)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C9H8F5N.ClH/c10-4-1-5(7(15)3-8(12)13)9(14)6(11)2-4;/h1-2,7-8H,3,15H2;1H/t7-;/m0./s1 |
| InChIKey | XSVYNDBPWWKZIQ-FJXQXJEOSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|