C8H7F4N — CID 131081639
(1S)-2-fluoro-1-(2,3,5-trifluorophenyl)ethanamine (PubChem CID 131081639) has the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. Its IUPAC name is (1S)-2-fluoro-1-(2,3,5-trifluorophenyl)ethanamine.
| Compound Name | (1S)-2-fluoro-1-(2,3,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 131081639 |
| Molecular Formula | C8H7F4N |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (1S)-2-fluoro-1-(2,3,5-trifluorophenyl)ethanamine |
| SMILES | N[C@H](CF)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C8H7F4N/c9-3-7(13)5-1-4(10)2-6(11)8(5)12/h1-2,7H,3,13H2/t7-/m1/s1 |
| InChIKey | KPPAPFDUHIUWOT-SSDOTTSWSA-N |
| XLogP | 2.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|