C9H9F3O — CID 59218730
2-(2,3,5-trifluorophenyl)propan-1-ol (PubChem CID 59218730) has the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. Its IUPAC name is 2-(2,3,5-trifluorophenyl)propan-1-ol.
| Compound Name | 2-(2,3,5-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 59218730 |
| Molecular Formula | C9H9F3O |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-(2,3,5-trifluorophenyl)propan-1-ol |
| SMILES | CC(CO)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C9H9F3O/c1-5(4-13)7-2-6(10)3-8(11)9(7)12/h2-3,5,13H,4H2,1H3 |
| InChIKey | SKTYHXXZXHXDMR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|