C10H11F3O — CID 130597949
2-methyl-1-(2,3,5-trifluorophenyl)propan-1-ol (PubChem CID 130597949) has the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-methyl-1-(2,3,5-trifluorophenyl)propan-1-ol.
| Compound Name | 2-methyl-1-(2,3,5-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130597949 |
| Molecular Formula | C10H11F3O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-methyl-1-(2,3,5-trifluorophenyl)propan-1-ol |
| SMILES | CC(C)C(O)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H11F3O/c1-5(2)10(14)7-3-6(11)4-8(12)9(7)13/h3-5,10,14H,1-2H3 |
| InChIKey | QOCLDHOZCKYVFR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|