C13H21F3O — CID 143774717
ethane;2-(3,4,5-trifluorophenyl)propan-1-ol (PubChem CID 143774717) has the molecular formula C13H21F3O and a molecular weight of 250.30 g/mol. Its IUPAC name is ethane;2-(3,4,5-trifluorophenyl)propan-1-ol.
| Compound Name | ethane;2-(3,4,5-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 143774717 |
| Molecular Formula | C13H21F3O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | ethane;2-(3,4,5-trifluorophenyl)propan-1-ol |
| SMILES | CC.CC.CC(CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H9F3O.2C2H6/c1-5(4-13)6-2-7(10)9(12)8(11)3-6;2*1-2/h2-3,5,13H,4H2,1H3;2*1-2H3 |
| InChIKey | QEYUKXKABMLFDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|